C18H16Cl2N4O2 — CID 135950012
2-[(6-chloro-4-oxo-3H-quinazolin-2-yl)methyl-methylamino]-N-(2-chlorophenyl)acetamide (PubChem CID 135950012) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 2-[(6-chloro-4-oxo-3H-quinazolin-2-yl)methyl-methylamino]-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-[(6-chloro-4-oxo-3H-quinazolin-2-yl)methyl-methylamino]-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 135950012 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[(6-chloro-4-oxo-3H-quinazolin-2-yl)methyl-methylamino]-N-(2-chlorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccccc1Cl)Cc1nc2ccc(Cl)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H16Cl2N4O2/c1-24(10-17(25)22-15-5-3-2-4-13(15)20)9-16-21-14-7-6-11(19)8-12(14)18(26)23-16/h2-8H,9-10H2,1H3,(H,22,25)(H,21,23,26) |
| InChIKey | RCOXWXIBJMPDTO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |