C26H27FN4O3 — CID 135951112
N-[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-(2-methoxyphenyl)carbonimidoyl]-4-methoxybenzamide (PubChem CID 135951112) has the molecular formula C26H27FN4O3 and a molecular weight of 462.53 g/mol. Its IUPAC name is N-[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-(2-methoxyphenyl)carbonimidoyl]-4-methoxybenzamide.
| Compound Name | N-[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-(2-methoxyphenyl)carbonimidoyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 135951112 |
| Molecular Formula | C26H27FN4O3 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[C-[4-(4-fluorophenyl)piperazin-1-yl]-N-(2-methoxyphenyl)carbonimidoyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=N\c2ccccc2OC)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O3/c1-33-22-13-7-19(8-14-22)25(32)29-26(28-23-5-3-4-6-24(23)34-2)31-17-15-30(16-18-31)21-11-9-20(27)10-12-21/h3-14H,15-18H2,1-2H3,(H,28,29,32) |
| InChIKey | ZXOVAMHLKGOWSW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|