C28H27ClN4O2 — CID 135951787
1-[(4-tert-butylphenyl)methyl]-3-(4-chlorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]pyrazole-5-carboxamide (PubChem CID 135951787) has the molecular formula C28H27ClN4O2 and a molecular weight of 487.00 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-3-(4-chlorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]pyrazole-5-carboxamide.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-3-(4-chlorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135951787 |
| Molecular Formula | C28H27ClN4O2 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-3-(4-chlorophenyl)-N-[(E)-(2-hydroxyphenyl)methylideneamino]pyrazole-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(Cn2nc(-c3ccc(Cl)cc3)cc2C(=O)N/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C28H27ClN4O2/c1-28(2,3)22-12-8-19(9-13-22)18-33-25(16-24(32-33)20-10-14-23(29)15-11-20)27(35)31-30-17-21-6-4-5-7-26(21)34/h4-17,34H,18H2,1-3H3,(H,31,35)/b30-17+ |
| InChIKey | JGZQWVDBFWRPIT-OCSSWDANSA-N |
| XLogP | 6.02 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|