C26H28N4OS — CID 135952053
(4R)-1-(1,3-benzothiazol-2-yl)-4-[(1R)-cyclohex-3-en-1-yl]-3,7,7-trimethyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 135952053) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is (4R)-1-(1,3-benzothiazol-2-yl)-4-[(1R)-cyclohex-3-en-1-yl]-3,7,7-trimethyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4R)-1-(1,3-benzothiazol-2-yl)-4-[(1R)-cyclohex-3-en-1-yl]-3,7,7-trimethyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135952053 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (4R)-1-(1,3-benzothiazol-2-yl)-4-[(1R)-cyclohex-3-en-1-yl]-3,7,7-trimethyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1nn(-c2nc3ccccc3s2)c2c1[C@@H]([C@H]1CC=CCC1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C26H28N4OS/c1-15-21-22(16-9-5-4-6-10-16)23-18(13-26(2,3)14-19(23)31)27-24(21)30(29-15)25-28-17-11-7-8-12-20(17)32-25/h4-5,7-8,11-12,16,22,27H,6,9-10,13-14H2,1-3H3/t16-,22+/m0/s1 |
| InChIKey | GIVACYCDGIYMJO-KSFYIVLOSA-N |
| XLogP | 6.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|