C21H25N3O — CID 135726741
(4S)-4-ethyl-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 135726741) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (4S)-4-ethyl-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S)-4-ethyl-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135726741 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (4S)-4-ethyl-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | CC[C@@H]1C2=C(CC(C)(C)CC2=O)Nc2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c1-5-15-18-13(2)23-24(14-9-7-6-8-10-14)20(18)22-16-11-21(3,4)12-17(25)19(15)16/h6-10,15,22H,5,11-12H2,1-4H3/t15-/m0/s1 |
| InChIKey | CYMDKYSYNIBVIS-HNNXBMFYSA-N |
| XLogP | 4.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |