C21H23N7O — CID 135680116
(9R)-9-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one (PubChem CID 135680116) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is (9R)-9-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one.
| Compound Name | (9R)-9-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135680116 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (9R)-9-(3,5-dimethyl-1-phenylpyrazol-4-yl)-6,6-dimethyl-4,5,7,9-tetrahydrotetrazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C2=C(CC(C)(C)CC2=O)Nc2nnnn21 |
| InChI | InChI=1S/C21H23N7O/c1-12-17(13(2)27(24-12)14-8-6-5-7-9-14)19-18-15(10-21(3,4)11-16(18)29)22-20-23-25-26-28(19)20/h5-9,19H,10-11H2,1-4H3,(H,22,23,26)/t19-/m1/s1 |
| InChIKey | DRNFATKOIDSETD-LJQANCHMSA-N |
| XLogP | 3.13 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |