C19H14ClN7O — CID 135968778
(8R)-8-(4-chlorophenyl)-10-methyl-12-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one (PubChem CID 135968778) has the molecular formula C19H14ClN7O and a molecular weight of 391.82 g/mol. Its IUPAC name is (8R)-8-(4-chlorophenyl)-10-methyl-12-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one.
| Compound Name | (8R)-8-(4-chlorophenyl)-10-methyl-12-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
|---|---|
| PubChem CID | 135968778 |
| Molecular Formula | C19H14ClN7O |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (8R)-8-(4-chlorophenyl)-10-methyl-12-phenyl-2,4,5,6,7,11,12-heptazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10-tetraen-13-one |
| SMILES | Cc1nn(-c2ccccc2)c(=O)c2c1[C@@H](c1ccc(Cl)cc1)n1nnnc1N2 |
| InChI | InChI=1S/C19H14ClN7O/c1-11-15-16(18(28)26(23-11)14-5-3-2-4-6-14)21-19-22-24-25-27(19)17(15)12-7-9-13(20)10-8-12/h2-10,17H,1H3,(H,21,22,25)/t17-/m1/s1 |
| InChIKey | UHVPILZQNCDKSG-QGZVFWFLSA-N |
| XLogP | 2.88 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |