C13H10ClN5OS — CID 141278456
8-(4-chlorophenyl)-12-thia-2,4,5,6,7-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-10-one (PubChem CID 141278456) has the molecular formula C13H10ClN5OS and a molecular weight of 319.78 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-12-thia-2,4,5,6,7-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-10-one.
| Compound Name | 8-(4-chlorophenyl)-12-thia-2,4,5,6,7-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-10-one |
|---|---|
| PubChem CID | 141278456 |
| Molecular Formula | C13H10ClN5OS |
| Molecular Weight | 319.78 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 8-(4-chlorophenyl)-12-thia-2,4,5,6,7-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-10-one |
| SMILES | O=C1CSCC2=C1C(c1ccc(Cl)cc1)n1nnnc1N2 |
| InChI | InChI=1S/C13H10ClN5OS/c14-8-3-1-7(2-4-8)12-11-9(5-21-6-10(11)20)15-13-16-17-18-19(12)13/h1-4,12H,5-6H2,(H,15,16,18) |
| InChIKey | KTTVNJHWVUPHEK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.78 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |