C16H15ClN6O — CID 135998620
2-(4-chlorophenyl)-4-methylidene-5-propyl-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-6-one (PubChem CID 135998620) has the molecular formula C16H15ClN6O and a molecular weight of 342.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-methylidene-5-propyl-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-6-one.
| Compound Name | 2-(4-chlorophenyl)-4-methylidene-5-propyl-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-6-one |
|---|---|
| PubChem CID | 135998620 |
| Molecular Formula | C16H15ClN6O |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(4-chlorophenyl)-4-methylidene-5-propyl-1,5,8,10,11,12-hexazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-6-one |
| SMILES | C=C1C2=C(Nc3nnnn3C2c2ccc(Cl)cc2)C(=O)N1CCC |
| InChI | InChI=1S/C16H15ClN6O/c1-3-8-22-9(2)12-13(15(22)24)18-16-19-20-21-23(16)14(12)10-4-6-11(17)7-5-10/h4-7,14H,2-3,8H2,1H3,(H,18,19,21) |
| InChIKey | ICGXLPAKWWSJJU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |