C28H32N4O — CID 136791624
(4R)-4-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 136791624) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is (4R)-4-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4R)-4-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136791624 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (4R)-4-(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)-3,7,7-trimethyl-1-phenyl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@@H](c1cc(C)n(C3CC3)c1C)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C28H32N4O/c1-16-13-21(18(3)31(16)19-11-12-19)25-24-17(2)30-32(20-9-7-6-8-10-20)27(24)29-22-14-28(4,5)15-23(33)26(22)25/h6-10,13,19,25,29H,11-12,14-15H2,1-5H3/t25-/m1/s1 |
| InChIKey | DELCHVFJSPRIGE-RUZDIDTESA-N |
| XLogP | 6.13 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |