C24H24ClN3OS — CID 135878545
(4S)-1-(3-chlorophenyl)-3,7,7-trimethyl-4-(3-methylthiophen-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 135878545) has the molecular formula C24H24ClN3OS and a molecular weight of 438.00 g/mol. Its IUPAC name is (4S)-1-(3-chlorophenyl)-3,7,7-trimethyl-4-(3-methylthiophen-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S)-1-(3-chlorophenyl)-3,7,7-trimethyl-4-(3-methylthiophen-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135878545 |
| Molecular Formula | C24H24ClN3OS |
| Molecular Weight | 438.00 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (4S)-1-(3-chlorophenyl)-3,7,7-trimethyl-4-(3-methylthiophen-2-yl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1ccsc1[C@@H]1C2=C(CC(C)(C)CC2=O)Nc2c1c(C)nn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClN3OS/c1-13-8-9-30-22(13)21-19-14(2)27-28(16-7-5-6-15(25)10-16)23(19)26-17-11-24(3,4)12-18(29)20(17)21/h5-10,21,26H,11-12H2,1-4H3/t21-/m0/s1 |
| InChIKey | CTAKUWBJEVMYHL-NRFANRHFSA-N |
| XLogP | 6.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.00 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |