C23H22FN3OS — CID 135784449
(4R)-1-(4-fluorophenyl)-3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 135784449) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is (4R)-1-(4-fluorophenyl)-3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4R)-1-(4-fluorophenyl)-3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135784449 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (4R)-1-(4-fluorophenyl)-3,7,7-trimethyl-4-thiophen-3-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2c1[C@@H](c1ccsc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C23H22FN3OS/c1-13-19-20(14-8-9-29-12-14)21-17(10-23(2,3)11-18(21)28)25-22(19)27(26-13)16-6-4-15(24)5-7-16/h4-9,12,20,25H,10-11H2,1-3H3/t20-/m1/s1 |
| InChIKey | VLWTZCAISCKMJP-HXUWFJFHSA-N |
| XLogP | 5.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |