C30H35N3O — CID 135438352
3-tert-butyl-7,7-dimethyl-1,4-bis(4-methylphenyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 135438352) has the molecular formula C30H35N3O and a molecular weight of 453.63 g/mol. Its IUPAC name is 3-tert-butyl-7,7-dimethyl-1,4-bis(4-methylphenyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | 3-tert-butyl-7,7-dimethyl-1,4-bis(4-methylphenyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135438352 |
| Molecular Formula | C30H35N3O |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | 3-tert-butyl-7,7-dimethyl-1,4-bis(4-methylphenyl)-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3c2c(C(C)(C)C)nn3-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O/c1-18-8-12-20(13-9-18)24-25-22(16-30(6,7)17-23(25)34)31-28-26(24)27(29(3,4)5)32-33(28)21-14-10-19(2)11-15-21/h8-15,24,31H,16-17H2,1-7H3 |
| InChIKey | JTRHUXIMNVKUSM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |