C22H22N4O6 — CID 135952524
(5S,8S)-8-(furan-2-yl)-5-(2,4,5-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one (PubChem CID 135952524) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is (5S,8S)-8-(furan-2-yl)-5-(2,4,5-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one.
| Compound Name | (5S,8S)-8-(furan-2-yl)-5-(2,4,5-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 135952524 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (5S,8S)-8-(furan-2-yl)-5-(2,4,5-trimethoxyphenyl)-4,5,7,8,9,10-hexahydro-[1,2,5]oxadiazolo[3,4-b][1,4]benzodiazepin-6-one |
| SMILES | COc1cc(OC)c([C@@H]2Nc3nonc3NC3=C2C(=O)C[C@@H](c2ccco2)C3)cc1OC |
| InChI | InChI=1S/C22H22N4O6/c1-28-16-10-18(30-3)17(29-2)9-12(16)20-19-13(23-21-22(24-20)26-32-25-21)7-11(8-14(19)27)15-5-4-6-31-15/h4-6,9-11,20H,7-8H2,1-3H3,(H,23,25)(H,24,26)/t11-,20-/m0/s1 |
| InChIKey | YMBHZJNKCBRMFF-YBTHPKLGSA-N |
| XLogP | 3.67 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |