C21H15F2N5O3 — CID 135953767
2-[(4R)-1-(2,4-difluorophenyl)-2',6-dioxospiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-1'-yl]acetamide (PubChem CID 135953767) has the molecular formula C21H15F2N5O3 and a molecular weight of 423.38 g/mol. Its IUPAC name is 2-[(4R)-1-(2,4-difluorophenyl)-2',6-dioxospiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-1'-yl]acetamide.
| Compound Name | 2-[(4R)-1-(2,4-difluorophenyl)-2',6-dioxospiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-1'-yl]acetamide |
|---|---|
| PubChem CID | 135953767 |
| Molecular Formula | C21H15F2N5O3 |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 2-[(4R)-1-(2,4-difluorophenyl)-2',6-dioxospiro[5,7-dihydropyrazolo[5,4-b]pyridine-4,3'-indole]-1'-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)[C@]2(CC(=O)Nc3c2cnn3-c2ccc(F)cc2F)c2ccccc21 |
| InChI | InChI=1S/C21H15F2N5O3/c22-11-5-6-16(14(23)7-11)28-19-13(9-25-28)21(8-18(30)26-19)12-3-1-2-4-15(12)27(20(21)31)10-17(24)29/h1-7,9H,8,10H2,(H2,24,29)(H,26,30)/t21-/m1/s1 |
| InChIKey | JCJZIIFSAZXJDC-OAQYLSRUSA-N |
| XLogP | 1.61 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |