C16H10ClN5OS — CID 135956500
(3Z)-3-[[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]imino]-1H-indol-2-one (PubChem CID 135956500) has the molecular formula C16H10ClN5OS and a molecular weight of 355.81 g/mol. Its IUPAC name is (3Z)-3-[[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]imino]-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]imino]-1H-indol-2-one |
|---|---|
| PubChem CID | 135956500 |
| Molecular Formula | C16H10ClN5OS |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | (3Z)-3-[[3-(4-chlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]imino]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/n1c(-c2ccc(Cl)cc2)n[nH]c1=S |
| InChI | InChI=1S/C16H10ClN5OS/c17-10-7-5-9(6-8-10)14-19-20-16(24)22(14)21-13-11-3-1-2-4-12(11)18-15(13)23/h1-8H,(H,20,24)(H,18,21,23) |
| InChIKey | ZPPYNJIGFCRHBB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|