C10H8N6OS — CID 135408120
3-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one (PubChem CID 135408120) has the molecular formula C10H8N6OS and a molecular weight of 260.28 g/mol. Its IUPAC name is 3-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one.
| Compound Name | 3-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one |
|---|---|
| PubChem CID | 135408120 |
| Molecular Formula | C10H8N6OS |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-[(3-amino-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1H-indol-2-one |
| SMILES | Nc1n[nH]c(=S)n1N=C1C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H8N6OS/c11-9-13-14-10(18)16(9)15-7-5-3-1-2-4-6(5)12-8(7)17/h1-4H,(H2,11,13)(H,14,18)(H,12,15,17) |
| InChIKey | PRKCMWUATRLCBA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|