C16H19N5OS — CID 6047997
(3Z)-3-[(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1-(2-methylpropyl)indol-2-one (PubChem CID 6047997) has the molecular formula C16H19N5OS and a molecular weight of 329.43 g/mol. Its IUPAC name is (3Z)-3-[(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1-(2-methylpropyl)indol-2-one.
| Compound Name | (3Z)-3-[(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1-(2-methylpropyl)indol-2-one |
|---|---|
| PubChem CID | 6047997 |
| Molecular Formula | C16H19N5OS |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (3Z)-3-[(3-ethyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)imino]-1-(2-methylpropyl)indol-2-one |
| SMILES | CCc1n[nH]c(=S)n1/N=C1\C(=O)N(CC(C)C)c2ccccc21 |
| InChI | InChI=1S/C16H19N5OS/c1-4-13-17-18-16(23)21(13)19-14-11-7-5-6-8-12(11)20(15(14)22)9-10(2)3/h5-8,10H,4,9H2,1-3H3,(H,18,23)/b19-14- |
| InChIKey | OUKGGWLAYGRIHD-RGEXLXHISA-N |
| XLogP | 2.76 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|