C11H12N4OS — CID 12539149
[(Z)-(1-acetyl-2H-indol-3-ylidene)amino]thiourea (PubChem CID 12539149) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is [(Z)-(1-acetyl-2H-indol-3-ylidene)amino]thiourea.
| Compound Name | [(Z)-(1-acetyl-2H-indol-3-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 12539149 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | [(Z)-(1-acetyl-2H-indol-3-ylidene)amino]thiourea |
| SMILES | CC(=O)N1C/C(=N\NC(N)=S)c2ccccc21 |
| InChI | InChI=1S/C11H12N4OS/c1-7(16)15-6-9(13-14-11(12)17)8-4-2-3-5-10(8)15/h2-5H,6H2,1H3,(H3,12,14,17)/b13-9+ |
| InChIKey | CJJZZMPQHNLLIP-UKTHLTGXSA-N |
| XLogP | 0.59 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|