C11H5F3N4OS — CID 3000333
2,2,2-trifluoro-1-(3-sulfanylidene-2H-[1,2,4]triazino[5,6-b]indol-5-yl)ethanone (PubChem CID 3000333) has the molecular formula C11H5F3N4OS and a molecular weight of 298.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-sulfanylidene-2H-[1,2,4]triazino[5,6-b]indol-5-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-sulfanylidene-2H-[1,2,4]triazino[5,6-b]indol-5-yl)ethanone |
|---|---|
| PubChem CID | 3000333 |
| Molecular Formula | C11H5F3N4OS |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-sulfanylidene-2H-[1,2,4]triazino[5,6-b]indol-5-yl)ethanone |
| SMILES | O=C(n1c2ccccc2c2n[nH]c(=S)nc21)C(F)(F)F |
| InChI | InChI=1S/C11H5F3N4OS/c12-11(13,14)9(19)18-6-4-2-1-3-5(6)7-8(18)15-10(20)17-16-7/h1-4H,(H,15,17,20) |
| InChIKey | AGSZBVGKWLFZNG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|