C12H12N4S — CID 694569
5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 694569) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is 5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 694569 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | CCCn1c2ccccc2c2n[nH]c(=S)nc21 |
| InChI | InChI=1S/C12H12N4S/c1-2-7-16-9-6-4-3-5-8(9)10-11(16)13-12(17)15-14-10/h3-6H,2,7H2,1H3,(H,13,15,17) |
| InChIKey | VKBHDEMYBUCXJW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|