C13H14N4S — CID 941411
8-methyl-5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione (PubChem CID 941411) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 8-methyl-5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione.
| Compound Name | 8-methyl-5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
|---|---|
| PubChem CID | 941411 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 8-methyl-5-propyl-2H-[1,2,4]triazino[5,6-b]indole-3-thione |
| SMILES | CCCn1c2ccc(C)cc2c2n[nH]c(=S)nc21 |
| InChI | InChI=1S/C13H14N4S/c1-3-6-17-10-5-4-8(2)7-9(10)11-12(17)14-13(18)16-15-11/h4-5,7H,3,6H2,1-2H3,(H,14,16,18) |
| InChIKey | XYQNZKJFVKLKFG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|