C9H8N4OS — CID 713886
6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 713886) has the molecular formula C9H8N4OS and a molecular weight of 220.26 g/mol. Its IUPAC name is 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 713886 |
| Molecular Formula | C9H8N4OS |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 6-(2-aminophenyl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | Nc1ccccc1-c1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C9H8N4OS/c10-6-4-2-1-3-5(6)7-8(14)11-9(15)13-12-7/h1-4H,10H2,(H2,11,13,14,15) |
| InChIKey | TZQIBJNEKJDVAM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|