C10H9BrN4OS — CID 6497057
6-[5-bromo-2-(methylamino)phenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 6497057) has the molecular formula C10H9BrN4OS and a molecular weight of 313.18 g/mol. Its IUPAC name is 6-[5-bromo-2-(methylamino)phenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one.
| Compound Name | 6-[5-bromo-2-(methylamino)phenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 6497057 |
| Molecular Formula | C10H9BrN4OS |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | 6-[5-bromo-2-(methylamino)phenyl]-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | CNc1ccc(Br)cc1-c1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C10H9BrN4OS/c1-12-7-3-2-5(11)4-6(7)8-9(16)13-10(17)15-14-8/h2-4,12H,1H3,(H2,13,15,16,17) |
| InChIKey | NAFBFBLUMIMJAZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|