About 4-bromo-N-methyl-2-phenylaniline;butanal
4-bromo-N-methyl-2-phenylaniline;butanal (PubChem CID 156801590) has the molecular formula C17H20BrNO
and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-bromo-N-methyl-2-phenylaniline;butanal.
Molecular Properties
| Compound Name | 4-bromo-N-methyl-2-phenylaniline;butanal |
| PubChem CID | 156801590 |
| Molecular Formula | C17H20BrNO |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 4-bromo-N-methyl-2-phenylaniline;butanal |
| SMILES | CCCC=O.CNc1ccc(Br)cc1-c1ccccc1 |
| InChI | InChI=1S/C13H12BrN.C4H8O/c1-15-13-8-7-11(14)9-12(13)10-5-3-2-4-6-10;1-2-3-4-5/h2-9,15H,1H3;4H,2-3H2,1H3 |
| InChIKey | WVPJKCSPOSYHNY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-N-methyl-2-phenylaniline;butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-methyl-2-phenylaniline;butanal?
The IUPAC name of 4-bromo-N-methyl-2-phenylaniline;butanal (CID 156801590) is 4-bromo-N-methyl-2-phenylaniline;butanal.
What is the SMILES notation for 4-bromo-N-methyl-2-phenylaniline;butanal?
The canonical SMILES for 4-bromo-N-methyl-2-phenylaniline;butanal is CCCC=O.CNc1ccc(Br)cc1-c1ccccc1.
What is the InChIKey of 4-bromo-N-methyl-2-phenylaniline;butanal?
The InChIKey is WVPJKCSPOSYHNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN.C4H8O/c1-15-13-8-7-11(14)9-12(13)10-5-3-2-4-6-10;1-2-3-4-5/h2-9,15H,1H3;4H,2-3H2,1H3.
What are the key properties of 4-bromo-N-methyl-2-phenylaniline;butanal?
4-bromo-N-methyl-2-phenylaniline;butanal has a molecular weight of 334.26 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-methyl-2-phenylaniline;butanal is sourced from PubChem (CID 156801590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).