C14H13Br2NS — CID 144892978
2,4-dibromo-N-methylaniline;thiobenzaldehyde (PubChem CID 144892978) has the molecular formula C14H13Br2NS and a molecular weight of 387.14 g/mol. Its IUPAC name is 2,4-dibromo-N-methylaniline;thiobenzaldehyde.
| Compound Name | 2,4-dibromo-N-methylaniline;thiobenzaldehyde |
|---|---|
| PubChem CID | 144892978 |
| Molecular Formula | C14H13Br2NS |
| Molecular Weight | 387.14 g/mol |
| Exact Mass | 384.91 |
| IUPAC Name | 2,4-dibromo-N-methylaniline;thiobenzaldehyde |
| SMILES | CNc1ccc(Br)cc1Br.S=Cc1ccccc1 |
| InChI | InChI=1S/C7H7Br2N.C7H6S/c1-10-7-3-2-5(8)4-6(7)9;8-6-7-4-2-1-3-5-7/h2-4,10H,1H3;1-6H |
| InChIKey | ABACMSSEEMUGHK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.14 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|