About benzene-1,3-diol;butanal
benzene-1,3-diol;butanal (PubChem CID 158563100) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is benzene-1,3-diol;butanal.
Molecular Properties
| Compound Name | benzene-1,3-diol;butanal |
| PubChem CID | 158563100 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | benzene-1,3-diol;butanal |
| SMILES | CCCC=O.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.C4H8O/c7-5-2-1-3-6(8)4-5;1-2-3-4-5/h1-4,7-8H;4H,2-3H2,1H3 |
| InChIKey | HRDAVCAJTRYBFF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-diol;butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-diol;butanal?
The IUPAC name of benzene-1,3-diol;butanal (CID 158563100) is benzene-1,3-diol;butanal.
What is the SMILES notation for benzene-1,3-diol;butanal?
The canonical SMILES for benzene-1,3-diol;butanal is CCCC=O.Oc1cccc(O)c1.
What is the InChIKey of benzene-1,3-diol;butanal?
The InChIKey is HRDAVCAJTRYBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C4H8O/c7-5-2-1-3-6(8)4-5;1-2-3-4-5/h1-4,7-8H;4H,2-3H2,1H3.
What are the key properties of benzene-1,3-diol;butanal?
benzene-1,3-diol;butanal has a molecular weight of 182.22 g/mol, XLogP of 2.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-diol;butanal is sourced from PubChem (CID 158563100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).