C16H14BrN3O — CID 131860498
3-(2-amino-5-bromophenyl)-6,7-dimethyl-1H-quinoxalin-2-one (PubChem CID 131860498) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 3-(2-amino-5-bromophenyl)-6,7-dimethyl-1H-quinoxalin-2-one.
| Compound Name | 3-(2-amino-5-bromophenyl)-6,7-dimethyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 131860498 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-(2-amino-5-bromophenyl)-6,7-dimethyl-1H-quinoxalin-2-one |
| SMILES | Cc1cc2nc(-c3cc(Br)ccc3N)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C16H14BrN3O/c1-8-5-13-14(6-9(8)2)20-16(21)15(19-13)11-7-10(17)3-4-12(11)18/h3-7H,18H2,1-2H3,(H,20,21) |
| InChIKey | GYJNAPXRGXXIOP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|