C13H10N6O2S2 — CID 23767829
1-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 23767829) has the molecular formula C13H10N6O2S2 and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 23767829 |
| Molecular Formula | C13H10N6O2S2 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(Nc1nccs1)Nc1ccccc1-c1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C13H10N6O2S2/c20-10-9(18-19-12(22)16-10)7-3-1-2-4-8(7)15-11(21)17-13-14-5-6-23-13/h1-6H,(H2,14,15,17,21)(H2,16,19,20,22) |
| InChIKey | BUEXSTCDBDNRMO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|