C12H7N7OS — CID 169339150
2-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]hydrazinylidene]propanedinitrile (PubChem CID 169339150) has the molecular formula C12H7N7OS and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]hydrazinylidene]propanedinitrile.
| Compound Name | 2-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339150 |
| Molecular Formula | C12H7N7OS |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1ccccc1-c1n[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C12H7N7OS/c13-5-7(6-14)16-17-9-4-2-1-3-8(9)10-11(20)15-12(21)19-18-10/h1-4,17H,(H2,15,19,20,21) |
| InChIKey | ZLZAJVMSKQRGEP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 133.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|