C12H10N6O — CID 169340786
2-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)hydrazinylidene]propanedinitrile (PubChem CID 169340786) has the molecular formula C12H10N6O and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169340786 |
| Molecular Formula | C12H10N6O |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cccc2c1NCCNC2=O |
| InChI | InChI=1S/C12H10N6O/c13-6-8(7-14)17-18-10-3-1-2-9-11(10)15-4-5-16-12(9)19/h1-3,15,18H,4-5H2,(H,16,19) |
| InChIKey | XDDUXFNSJLZJGW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|