C12H13N7O — CID 172979134
(1Z)-2-amino-2-imino-N-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]ethanimidoyl cyanide (PubChem CID 172979134) has the molecular formula C12H13N7O and a molecular weight of 271.28 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979134 |
| Molecular Formula | C12H13N7O |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[(5-oxo-1,2,3,4-tetrahydro-1,4-benzodiazepin-9-yl)amino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1cccc2c1NCCNC2=O |
| InChI | InChI=1S/C12H13N7O/c13-6-9(11(14)15)19-18-8-3-1-2-7-10(8)16-4-5-17-12(7)20/h1-3,16,18H,4-5H2,(H3,14,15)(H,17,20)/b19-9+ |
| InChIKey | KXBBQZFTMQRAMS-DJKKODMXSA-N |
| XLogP | 0.07 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|