C12H12N6O2 — CID 172978314
(1Z)-2-amino-2-imino-N-[(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)amino]ethanimidoyl cyanide (PubChem CID 172978314) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)amino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)amino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978314 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[(5-oxo-3,4-dihydro-2H-1,4-benzoxazepin-7-yl)amino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc2c(c1)C(=O)NCCO2 |
| InChI | InChI=1S/C12H12N6O2/c13-6-9(11(14)15)18-17-7-1-2-10-8(5-7)12(19)16-3-4-20-10/h1-2,5,17H,3-4H2,(H3,14,15)(H,16,19)/b18-9+ |
| InChIKey | FDCRANOQXBIMCM-GIJQJNRQSA-N |
| XLogP | 0.04 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|