C11H7F3N4O2S — CID 3000331
2,2,2-trifluoro-N-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]acetamide (PubChem CID 3000331) has the molecular formula C11H7F3N4O2S and a molecular weight of 316.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3000331 |
| Molecular Formula | C11H7F3N4O2S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(5-oxo-3-sulfanylidene-2H-1,2,4-triazin-6-yl)phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1-c1n[nH]c(=S)[nH]c1=O)C(F)(F)F |
| InChI | InChI=1S/C11H7F3N4O2S/c12-11(13,14)9(20)15-6-4-2-1-3-5(6)7-8(19)16-10(21)18-17-7/h1-4H,(H,15,20)(H2,16,18,19,21) |
| InChIKey | OZQNVCWAOORAGI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|