C25H17F3N6O2S3 — CID 3001564
2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(phenylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide (PubChem CID 3001564) has the molecular formula C25H17F3N6O2S3 and a molecular weight of 586.65 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(phenylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(phenylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 3001564 |
| Molecular Formula | C25H17F3N6O2S3 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[5-oxo-2,4-bis(phenylcarbamothioyl)-3-sulfanylidene-1,2,4-triazin-6-yl]phenyl]acetamide |
| SMILES | O=C(Nc1ccccc1-c1nn(C(=S)Nc2ccccc2)c(=S)n(C(=S)Nc2ccccc2)c1=O)C(F)(F)F |
| InChI | InChI=1S/C25H17F3N6O2S3/c26-25(27,28)21(36)31-18-14-8-7-13-17(18)19-20(35)33(22(37)29-15-9-3-1-4-10-15)24(39)34(32-19)23(38)30-16-11-5-2-6-12-16/h1-14H,(H,29,37)(H,30,38)(H,31,36) |
| InChIKey | XUXMPNJLGQRKNN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|