C15H13F2N5O — CID 171357876
6-(2-amino-5-fluorophenyl)-3-(4-fluoroanilino)-3,4-dihydro-2H-1,2,4-triazin-5-one (PubChem CID 171357876) has the molecular formula C15H13F2N5O and a molecular weight of 317.30 g/mol. Its IUPAC name is 6-(2-amino-5-fluorophenyl)-3-(4-fluoroanilino)-3,4-dihydro-2H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-amino-5-fluorophenyl)-3-(4-fluoroanilino)-3,4-dihydro-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 171357876 |
| Molecular Formula | C15H13F2N5O |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 6-(2-amino-5-fluorophenyl)-3-(4-fluoroanilino)-3,4-dihydro-2H-1,2,4-triazin-5-one |
| SMILES | Nc1ccc(F)cc1C1=NNC(Nc2ccc(F)cc2)NC1=O |
| InChI | InChI=1S/C15H13F2N5O/c16-8-1-4-10(5-2-8)19-15-20-14(23)13(21-22-15)11-7-9(17)3-6-12(11)18/h1-7,15,19,22H,18H2,(H,20,23) |
| InChIKey | IWCOUWDZZGKCRW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|