C9H9FN4OS — CID 171347228
6-(2-amino-5-fluorophenyl)-3-sulfanyl-3,4-dihydro-2H-1,2,4-triazin-5-one (PubChem CID 171347228) has the molecular formula C9H9FN4OS and a molecular weight of 240.26 g/mol. Its IUPAC name is 6-(2-amino-5-fluorophenyl)-3-sulfanyl-3,4-dihydro-2H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-amino-5-fluorophenyl)-3-sulfanyl-3,4-dihydro-2H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 171347228 |
| Molecular Formula | C9H9FN4OS |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 6-(2-amino-5-fluorophenyl)-3-sulfanyl-3,4-dihydro-2H-1,2,4-triazin-5-one |
| SMILES | Nc1ccc(F)cc1C1=NNC(S)NC1=O |
| InChI | InChI=1S/C9H9FN4OS/c10-4-1-2-6(11)5(3-4)7-8(15)12-9(16)14-13-7/h1-3,9,14,16H,11H2,(H,12,15) |
| InChIKey | PQDZJWQFZPNLLN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|