C11H12F2N4O2S — CID 139221812
N-[2-[2-(2-carbamothioylhydrazinyl)-1,1-difluoro-2-oxoethyl]phenyl]acetamide (PubChem CID 139221812) has the molecular formula C11H12F2N4O2S and a molecular weight of 302.31 g/mol. Its IUPAC name is N-[2-[2-(2-carbamothioylhydrazinyl)-1,1-difluoro-2-oxoethyl]phenyl]acetamide.
| Compound Name | N-[2-[2-(2-carbamothioylhydrazinyl)-1,1-difluoro-2-oxoethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139221812 |
| Molecular Formula | C11H12F2N4O2S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[2-[2-(2-carbamothioylhydrazinyl)-1,1-difluoro-2-oxoethyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C(F)(F)C(=O)NNC(N)=S |
| InChI | InChI=1S/C11H12F2N4O2S/c1-6(18)15-8-5-3-2-4-7(8)11(12,13)9(19)16-17-10(14)20/h2-5H,1H3,(H,15,18)(H,16,19)(H3,14,17,20) |
| InChIKey | BSRZYGNIPOICBV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|