C19H16F3NO3 — CID 135957282
ethyl (E)-3-hydroxy-3-phenyl-2-[4-(trifluoromethyl)benzenecarboximidoyl]prop-2-enoate (PubChem CID 135957282) has the molecular formula C19H16F3NO3 and a molecular weight of 363.34 g/mol. Its IUPAC name is ethyl (E)-3-hydroxy-3-phenyl-2-[4-(trifluoromethyl)benzenecarboximidoyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-hydroxy-3-phenyl-2-[4-(trifluoromethyl)benzenecarboximidoyl]prop-2-enoate |
|---|---|
| PubChem CID | 135957282 |
| Molecular Formula | C19H16F3NO3 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl (E)-3-hydroxy-3-phenyl-2-[4-(trifluoromethyl)benzenecarboximidoyl]prop-2-enoate |
| SMILES | [H]/N=C(C(/C(=O)OCC)=C(\O)c1ccccc1)\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3NO3/c1-2-26-18(25)15(17(24)13-6-4-3-5-7-13)16(23)12-8-10-14(11-9-12)19(20,21)22/h3-11,23-24H,2H2,1H3/b17-15+,23-16+ |
| InChIKey | QFEPCMNOZBLPGS-XYKMIDAESA-N |
| XLogP | 4.61 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|