C14H13FN2O5S — CID 135958014
4-fluoro-N-[(Z)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]benzenesulfonamide (PubChem CID 135958014) has the molecular formula C14H13FN2O5S and a molecular weight of 340.33 g/mol. Its IUPAC name is 4-fluoro-N-[(Z)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[(Z)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 135958014 |
| Molecular Formula | C14H13FN2O5S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 4-fluoro-N-[(Z)-1-(4-hydroxy-6-methyl-2-oxopyran-3-yl)ethylideneamino]benzenesulfonamide |
| SMILES | C/C(=N/NS(=O)(=O)c1ccc(F)cc1)c1c(O)cc(C)oc1=O |
| InChI | InChI=1S/C14H13FN2O5S/c1-8-7-12(18)13(14(19)22-8)9(2)16-17-23(20,21)11-5-3-10(15)4-6-11/h3-7,17-18H,1-2H3/b16-9- |
| InChIKey | AAHOQYQCQJNPPT-SXGWCWSVSA-N |
| XLogP | 1.50 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|