C18H15N5O4 — CID 135958148
(4S)-N-(2-methyl-4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-4-carboxamide (PubChem CID 135958148) has the molecular formula C18H15N5O4 and a molecular weight of 365.35 g/mol. Its IUPAC name is (4S)-N-(2-methyl-4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-4-carboxamide.
| Compound Name | (4S)-N-(2-methyl-4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 135958148 |
| Molecular Formula | C18H15N5O4 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | (4S)-N-(2-methyl-4-nitrophenyl)-2-oxo-3,4-dihydro-1H-pyrimido[1,2-a]benzimidazole-4-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H]1CC(=O)Nc2nc3ccccc3n21 |
| InChI | InChI=1S/C18H15N5O4/c1-10-8-11(23(26)27)6-7-12(10)19-17(25)15-9-16(24)21-18-20-13-4-2-3-5-14(13)22(15)18/h2-8,15H,9H2,1H3,(H,19,25)(H,20,21,24)/t15-/m0/s1 |
| InChIKey | QTAIEOVYVRVYFW-HNNXBMFYSA-N |
| XLogP | 2.77 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|