C28H29N3O3S — CID 135958753
(2Z,5R)-2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 135958753) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is (2Z,5R)-2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5R)-2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135958753 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (2Z,5R)-2-[(Z)-(3-methoxy-4-phenylmethoxyphenyl)methylidenehydrazinylidene]-5-[(4-propan-2-ylphenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=N\N=C2\NC(=O)[C@@H](Cc3ccc(C(C)C)cc3)S2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H29N3O3S/c1-19(2)23-12-9-20(10-13-23)16-26-27(32)30-28(35-26)31-29-17-22-11-14-24(25(15-22)33-3)34-18-21-7-5-4-6-8-21/h4-15,17,19,26H,16,18H2,1-3H3,(H,30,31,32)/b29-17-/t26-/m1/s1 |
| InChIKey | DOVQQILHVLSGKT-XAVTVXAQSA-N |
| XLogP | 5.56 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|