C22H22ClN3O3S — CID 135959139
(4R,6R)-1-(2-chlorophenyl)-4-(2,3-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one (PubChem CID 135959139) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is (4R,6R)-1-(2-chlorophenyl)-4-(2,3-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one.
| Compound Name | (4R,6R)-1-(2-chlorophenyl)-4-(2,3-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135959139 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | (4R,6R)-1-(2-chlorophenyl)-4-(2,3-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
| SMILES | COc1cccc([C@@H]2S[C@H](C)C(=O)Nc3c2c(C)nn3-c2ccccc2Cl)c1OC |
| InChI | InChI=1S/C22H22ClN3O3S/c1-12-18-20(14-8-7-11-17(28-3)19(14)29-4)30-13(2)22(27)24-21(18)26(25-12)16-10-6-5-9-15(16)23/h5-11,13,20H,1-4H3,(H,24,27)/t13-,20+/m1/s1 |
| InChIKey | UQYJHHINUISCIB-XCLFUZPHSA-N |
| XLogP | 5.01 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |