C22H23N3O3S — CID 135701795
(4S,6S)-4-(2,5-dimethoxyphenyl)-3,6-dimethyl-1-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one (PubChem CID 135701795) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (4S,6S)-4-(2,5-dimethoxyphenyl)-3,6-dimethyl-1-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one.
| Compound Name | (4S,6S)-4-(2,5-dimethoxyphenyl)-3,6-dimethyl-1-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135701795 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (4S,6S)-4-(2,5-dimethoxyphenyl)-3,6-dimethyl-1-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
| SMILES | COc1ccc(OC)c([C@H]2S[C@@H](C)C(=O)Nc3c2c(C)nn3-c2ccccc2)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-13-19-20(17-12-16(27-3)10-11-18(17)28-4)29-14(2)22(26)23-21(19)25(24-13)15-8-6-5-7-9-15/h5-12,14,20H,1-4H3,(H,23,26)/t14-,20+/m0/s1 |
| InChIKey | RXMKMUHUKXFPMY-VBKZILBWSA-N |
| XLogP | 4.36 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |