C20H21N5OS — CID 135701985
(4R,6R)-1-(4,6-dimethylpyrimidin-2-yl)-3,6-dimethyl-4-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one (PubChem CID 135701985) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is (4R,6R)-1-(4,6-dimethylpyrimidin-2-yl)-3,6-dimethyl-4-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one.
| Compound Name | (4R,6R)-1-(4,6-dimethylpyrimidin-2-yl)-3,6-dimethyl-4-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135701985 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (4R,6R)-1-(4,6-dimethylpyrimidin-2-yl)-3,6-dimethyl-4-phenyl-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
| SMILES | Cc1cc(C)nc(-n2nc(C)c3c2NC(=O)[C@@H](C)S[C@@H]3c2ccccc2)n1 |
| InChI | InChI=1S/C20H21N5OS/c1-11-10-12(2)22-20(21-11)25-18-16(13(3)24-25)17(15-8-6-5-7-9-15)27-14(4)19(26)23-18/h5-10,14,17H,1-4H3,(H,23,26)/t14-,17-/m1/s1 |
| InChIKey | HCEBVAWNPLAJQB-RHSMWYFYSA-N |
| XLogP | 3.75 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |