C21H21N3O2S — CID 135701849
(4S,6S)-4-(3-hydroxyphenyl)-3,6-dimethyl-1-(4-methylphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one (PubChem CID 135701849) has the molecular formula C21H21N3O2S and a molecular weight of 379.49 g/mol. Its IUPAC name is (4S,6S)-4-(3-hydroxyphenyl)-3,6-dimethyl-1-(4-methylphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one.
| Compound Name | (4S,6S)-4-(3-hydroxyphenyl)-3,6-dimethyl-1-(4-methylphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135701849 |
| Molecular Formula | C21H21N3O2S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | (4S,6S)-4-(3-hydroxyphenyl)-3,6-dimethyl-1-(4-methylphenyl)-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-7-one |
| SMILES | Cc1ccc(-n2nc(C)c3c2NC(=O)[C@H](C)S[C@H]3c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C21H21N3O2S/c1-12-7-9-16(10-8-12)24-20-18(13(2)23-24)19(27-14(3)21(26)22-20)15-5-4-6-17(25)11-15/h4-11,14,19,25H,1-3H3,(H,22,26)/t14-,19-/m0/s1 |
| InChIKey | ZWNJSFAIHDFWSJ-LIRRHRJNSA-N |
| XLogP | 4.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |