C22H21N3O3S — CID 135701856
4-[(4S,6R)-3,6-dimethyl-1-(4-methylphenyl)-7-oxo-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-4-yl]benzoic acid (PubChem CID 135701856) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is 4-[(4S,6R)-3,6-dimethyl-1-(4-methylphenyl)-7-oxo-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-4-yl]benzoic acid.
| Compound Name | 4-[(4S,6R)-3,6-dimethyl-1-(4-methylphenyl)-7-oxo-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 135701856 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-[(4S,6R)-3,6-dimethyl-1-(4-methylphenyl)-7-oxo-4,8-dihydropyrazolo[5,4-e][1,4]thiazepin-4-yl]benzoic acid |
| SMILES | Cc1ccc(-n2nc(C)c3c2NC(=O)[C@@H](C)S[C@H]3c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c1-12-4-10-17(11-5-12)25-20-18(13(2)24-25)19(29-14(3)21(26)23-20)15-6-8-16(9-7-15)22(27)28/h4-11,14,19H,1-3H3,(H,23,26)(H,27,28)/t14-,19+/m1/s1 |
| InChIKey | SXESTPXLIUGUAD-KUHUBIRLSA-N |
| XLogP | 4.35 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |