C15H26O2Si — CID 135959685
tert-butyl-(6-methoxy-2-methyl-5-methylidenecyclohexa-1,3-dien-1-yl)oxy-dimethylsilane (PubChem CID 135959685) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is tert-butyl-(6-methoxy-2-methyl-5-methylidenecyclohexa-1,3-dien-1-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(6-methoxy-2-methyl-5-methylidenecyclohexa-1,3-dien-1-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 135959685 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl-(6-methoxy-2-methyl-5-methylidenecyclohexa-1,3-dien-1-yl)oxy-dimethylsilane |
| SMILES | C=C1C=CC(C)=C(O[Si](C)(C)C(C)(C)C)C1OC |
| InChI | InChI=1S/C15H26O2Si/c1-11-9-10-12(2)14(13(11)16-6)17-18(7,8)15(3,4)5/h9-10,13H,1H2,2-8H3 |
| InChIKey | FSHFFKFDLFUNOL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|