C27H34N4O3 — CID 135960018
[3-(cyclopentylmethyl)-6-hydroxy-2H-indazol-5-yl]-[5-[3-(dimethylamino)propoxy]-1,3-dihydroisoindol-2-yl]methanone (PubChem CID 135960018) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is [3-(cyclopentylmethyl)-6-hydroxy-2H-indazol-5-yl]-[5-[3-(dimethylamino)propoxy]-1,3-dihydroisoindol-2-yl]methanone.
| Compound Name | [3-(cyclopentylmethyl)-6-hydroxy-2H-indazol-5-yl]-[5-[3-(dimethylamino)propoxy]-1,3-dihydroisoindol-2-yl]methanone |
|---|---|
| PubChem CID | 135960018 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [3-(cyclopentylmethyl)-6-hydroxy-2H-indazol-5-yl]-[5-[3-(dimethylamino)propoxy]-1,3-dihydroisoindol-2-yl]methanone |
| SMILES | CN(C)CCCOc1ccc2c(c1)CN(C(=O)c1cc3c(CC4CCCC4)[nH]nc3cc1O)C2 |
| InChI | InChI=1S/C27H34N4O3/c1-30(2)10-5-11-34-21-9-8-19-16-31(17-20(19)13-21)27(33)23-14-22-24(12-18-6-3-4-7-18)28-29-25(22)15-26(23)32/h8-9,13-15,18,32H,3-7,10-12,16-17H2,1-2H3,(H,28,29) |
| InChIKey | JIQIAMAVRQMCJB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|