C26H34N2O5 — CID 143771227
1-[5-[5-[3-(dipropylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]-2,4-dihydroxyphenyl]ethanone (PubChem CID 143771227) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 1-[5-[5-[3-(dipropylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]-2,4-dihydroxyphenyl]ethanone.
| Compound Name | 1-[5-[5-[3-(dipropylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]-2,4-dihydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 143771227 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[5-[5-[3-(dipropylamino)propoxy]-1,3-dihydroisoindole-2-carbonyl]-2,4-dihydroxyphenyl]ethanone |
| SMILES | CCCN(CCC)CCCOc1ccc2c(c1)CN(C(=O)c1cc(C(C)=O)c(O)cc1O)C2 |
| InChI | InChI=1S/C26H34N2O5/c1-4-9-27(10-5-2)11-6-12-33-21-8-7-19-16-28(17-20(19)13-21)26(32)23-14-22(18(3)29)24(30)15-25(23)31/h7-8,13-15,30-31H,4-6,9-12,16-17H2,1-3H3 |
| InChIKey | ZRBBNJJKBIPKDD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|